Thiazole, 2-amino-5-ethyl-4-phenyl-, 1,2-ethanedisulfonate (2:1)
ethane-1,2-disulfonic acid;bis(5-ethyl-4-phenyl-1,3-thiazol-2-amine)
Also Known As: C11H12N2S.1/2C2H6O6S2|Thiazole, 2-amino-5-ethyl-4-phenyl-, 1,2-ethanedisulfonate (2:1)|2-Amino-5-ethyl-4-phenylthiazole 1,2-ethanedisulfonate (2:1)|C11-H12-N2-S.1/2C2-H6-O6-S2|1,2-Ethane disulfonic acid, compd. with 2-amino-5-ethyl-4-phenylthiazole (1:2)|ethane-1,2-disulfonic acid- 5-ethyl-4-phenyl-1,3-thiazol-2-amine(1:2)|ethane-1,2-disulfonic acid,5-ethyl-4-phenyl-1,3-thiazol-2-amine|ethane-1,2-disulfonic acid; 5-ethyl-4-phenyl-1,3-thiazol-2-amine|Ethane-1,2-disulfonic acid--5-ethyl-4-phenyl-1,3-thiazol-2-amine (1/2)|1,2-Ethane disulfonic acid,compd. with 2-amino-5-ethyl-4-phenylthiazole (1:2)
| Molecular Formula | C24H30N4O6S4 |
|---|---|
| Molecular Weight | 598.1048 g/mol |
| LogP | 4.6714 |
| Topological Polar Surface Area | 260.0 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Exact Mass | 598.1048 |
| Monoisotopic Mass | 598.1048 |
| Heavy Atoms | 38 |
| Complexity | 419.0 |
Chemical Identifiers
| CAS Number | 36772-40-4 |
|---|---|
| SMILES | CCC1=C(N=C(S1)N)C2=CC=CC=C2.CCC1=C(N=C(S1)N)C2=CC=CC=C2.C(CS(=O)(=O)O)S(=O)(=O)O |
| InChIKey | FUDQPNRWKDLWRA-UHFFFAOYSA-N |
Product Overview
Thiazole, 2-amino-5-ethyl-4-phenyl-, 1,2-ethanedisulfonate (2:1) (CAS 36772-40-4), with molecular formula C24H30N4O6S4 and molecular weight 598.1048 g/mol. IUPAC: ethane-1,2-disulfonic acid;bis(5-ethyl-4-phenyl-1,3-thiazol-2-amine).