[1-[2-(2-Methylphenoxy)ethyl]indol-3-yl]-(4-methylpiperidin-1-yl)methanethione
[1-[2-(2-methylphenoxy)ethyl]indol-3-yl]-(4-methylpiperidin-1-yl)methanethione
Also Known As: [1-[2-(2-methylphenoxy)ethyl]indol-3-yl]-(4-methylpiperidin-1-yl)methanethione|AK-968/40809348|2-methylphenyl 2-{3-[(4-methyl-1-piperidinyl)carbothioyl]-1H-indol-1-yl}ethyl ether|(4-methylpiperidin-1-yl)(1-(2-(o-tolyloxy)ethyl)-1H-indol-3-yl)methanethione|{1-[2-(2-methylphenoxy)ethyl]-1H-indol-3-yl}(4-methylpiperidin-1-yl)methanethione|1-[2-(2-METHYLPHENOXY)ETHYL]-3-(4-METHYLPIPERIDINE-1-CARBOTHIOYL)-1H-INDOLE
| Molecular Formula | C24H28N2OS |
|---|---|
| Molecular Weight | 392.19223 g/mol |
| LogP | 5.43612 |
| Topological Polar Surface Area | 17.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Exact Mass | 392.19223 |
| Monoisotopic Mass | 392.19223 |
| Heavy Atoms | 28 |
| Complexity | 969.6505 |
Chemical Identifiers
| CAS Number | 369403-61-2 |
|---|---|
| SMILES | CC1CCN(CC1)C(=S)C2=CN(C3=CC=CC=C32)CCOC4=CC=CC=C4C |
Product Overview
[1-[2-(2-Methylphenoxy)ethyl]indol-3-yl]-(4-methylpiperidin-1-yl)methanethione (CAS 369403-61-2), with molecular formula C24H28N2OS and molecular weight 392.19223 g/mol. IUPAC: [1-[2-(2-methylphenoxy)ethyl]indol-3-yl]-(4-methylpiperidin-1-yl)methanethione.