2-Chloro-2'-methoxy-5'-methylacetanilide
2-chloro-N-(2-methoxy-5-methylphenyl)acetamide
Also Known As: 2-chloro-N-(2-methoxy-5-methylphenyl)acetamide|Validamine|2-CHLORO-N- ACETAMIDE|N1-(2-methoxy-5-methylphenyl)-2-chloroacetamide|JS-2984|Acetamide, 2-chloro-N-(2-methoxy-5-methylphenyl)-|NCGC00661131-01|2-(1-Phenyl-1H-pyrazol-4-yl)-ethylamine|N-(Chloroacetyl)-2-methoxy-5-methylaniline|2-CHLORO-2'-METHOXY-5'-METHYLACETANILIDE|BB 0243206|N-(ISOPROPYL)PIPERAZINE-2-CARBOXAMIDE|10.14272/ZVVBFKIUBBHWEV-UHFFFAOYSA-N|2-chloro-N-(2-methoxy-5-methyl-phenyl)acetamide|doi:10.14272/ZVVBFKIUBBHWEV-UHFFFAOYSA-N|2-Chloro-N-(2-methoxy-5-methyl-phenyl)-acet amide|661-132-8
| Molecular Formula | C10H12ClNO2 |
|---|---|
| Molecular Weight | 213.05565 g/mol |
| LogP | 2.1 |
| Topological Polar Surface Area | 38.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 213.05565 |
| Monoisotopic Mass | 213.05565 |
| Heavy Atoms | 14 |
| Complexity | 199.0 |
Chemical Identifiers
| CAS Number | 369652-04-0 |
|---|---|
| SMILES | CC1=CC(=C(C=C1)OC)NC(=O)CCl |
| InChIKey | ZVVBFKIUBBHWEV-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-Chloro-2'-methoxy-5'-methylacetanilide (CAS 369652-04-0), with molecular formula C10H12ClNO2 and molecular weight 213.05565 g/mol. IUPAC: 2-chloro-N-(2-methoxy-5-methylphenyl)acetamide.