Benzene, 1-methyl-4-(phenylthio)-
1-methyl-4-phenylsulfanylbenzene
Also Known As: Phenyl p-Tolyl Sulfide|4-METHYLDIPHENYL SULFIDE|Phenyl(p-tolyl)sulfane|4-Methyl diphenyl sulfide|4-phenylthiotoluene|Benzene, 1-methyl-4-(phenylthio)-|1-methyl-4-phenylsulfanylbenzene|4-aminobenzoic acid|phenyl-p-tolyl sulfide|4-(Phenylthio)toluene|p-Tolyl phenyl sulfide|(p-Tolyl)phenyl sulfide|Phenyl(p-tolyl) sulfide|1-methyl-4-(phenylsulfanyl)benzene|ACMC-2097dw|(Phenyl)(p-tolyl) sulfide|4-Methylphenylphenyl sulfide|Phenyl 4-methylphenyl sulfide|4-METHYLDIPHENYLSULFIDE|(p-Methylphenyl)phenyl sulfide|(4-methylphenyl)phenyl sulfide|Phenyl(4-methylphenyl) sulfide|1-methyl-4-(phenylthio)benzene|1-methyl-4-phenylsulfanyl-benzene|Benzene,1-methyl-4-(phenylthio)-|4-Methyl-(1,1 -thiobisbenzene)|L747
| Molecular Formula | C13H12S |
|---|---|
| Molecular Weight | 200.06598 g/mol |
| LogP | 4.8 |
| Topological Polar Surface Area | 25.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 200.06598 |
| Monoisotopic Mass | 200.06598 |
| Heavy Atoms | 14 |
| Complexity | 153.0 |
Chemical Identifiers
| CAS Number | 3699-01-2 |
|---|---|
| SMILES | CC1=CC=C(C=C1)SC2=CC=CC=C2 |
| InChIKey | CPZFPNKPHBCUOB-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 8 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Benzene, 1-methyl-4-(phenylthio)- (CAS 3699-01-2), with molecular formula C13H12S and molecular weight 200.06598 g/mol. IUPAC: 1-methyl-4-phenylsulfanylbenzene.