Ethyl 5-(acetyloxy)-1-benzyl-2-methyl-1H-indole-3-carboxylate
ethyl 5-acetyloxy-1-benzyl-2-methylindole-3-carboxylate
Also Known As: ChemDiv3_001560|Oprea1_626389|IDI1_020526|NCGC00305853-01|AB01302126-01|ethyl 5-acetyloxy-1-benzyl-2-methylindole-3-carboxylate|SR-01000438627-1|BRD-K15029391-001-01-2|3-(ethoxycarbonyl)-2-methyl-1-benzylindol-5-yl acetate|Ethyl 5-(acetyloxy)-1-benzyl-2-methyl-1H-indole-3-carboxylate|A0707/0032989|ethyl 5-acetoxy-1-benzyl-2-methyl-1H-indole-3-carboxylate|Ethyl 5-(acetyloxy)-1-benzyl-2-methyl-1H-indole-3-carboxylate #|Indole-3-carboxylic acid, 5-acetoxy-1-benzyl-2-methyl-, ethyl ester
| Molecular Formula | C21H21NO4 |
|---|---|
| Molecular Weight | 351.14706 g/mol |
| LogP | 4.0 |
| Topological Polar Surface Area | 57.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Exact Mass | 351.14706 |
| Monoisotopic Mass | 351.14706 |
| Heavy Atoms | 26 |
| Complexity | 502.0 |
Chemical Identifiers
| CAS Number | 37075-91-5 |
|---|---|
| SMILES | CCOC(=O)C1=C(N(C2=C1C=C(C=C2)OC(=O)C)CC3=CC=CC=C3)C |
| InChIKey | VSLRICCFOMBSKJ-UHFFFAOYSA-N |
Product Overview
Ethyl 5-(acetyloxy)-1-benzyl-2-methyl-1H-indole-3-carboxylate (CAS 37075-91-5), with molecular formula C21H21NO4 and molecular weight 351.14706 g/mol. IUPAC: ethyl 5-acetyloxy-1-benzyl-2-methylindole-3-carboxylate.