AC1LYM0D
4-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]butanamide
Also Known As: (Z)-N-(4-chloro-3-(trifluoromethyl)phenyl)-4-(5-(2-chlorobenzylidene)-4-oxo-2-thioxothiazolidin-3-yl)butanamide|4-[(5Z)-5-(2-chlorobenzylidene)-4-oxo-2-thioxo-1,3-thiazolidin-3-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]butanamide|4-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]butanamide
| Molecular Formula | C21H15Cl2F3N2O2S2 |
|---|---|
| Molecular Weight | 517.9904 g/mol |
| LogP | 6.6323 |
| Topological Polar Surface Area | 49.41 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Exact Mass | 517.9904 |
| Monoisotopic Mass | 517.9904 |
| Heavy Atoms | 32 |
| Complexity | 1106.6926 |
Chemical Identifiers
| CAS Number | 370855-93-9 |
|---|---|
| SMILES | C1=CC=C(C(=C1)/C=C\2/C(=O)N(C(=S)S2)CCCC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F)Cl |
Product Overview
AC1LYM0D (CAS 370855-93-9), with molecular formula C21H15Cl2F3N2O2S2 and molecular weight 517.9904 g/mol. IUPAC: 4-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]butanamide.