Camphorated phenol
phenol;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one
Also Known As: Campho-phenique|Carbol camphor|Camphorated phenol|Phenolated camphor|Carbolated camphor|Camphor-phenol|Phenol, camphorated|Camphor - phenol|Camphor, phenol drug combination|phenol;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one|Bicyclo(2.2.1)heptan-2-one, 1,7,7-trimethyl-, mixt. with phenol|phenol,4,7,7-trimethylbicyclo[2.2.1]heptan-3-one|phenol; 4,7,7-trimethylbicyclo[2.2.1]heptan-3-one|1,7,7-Trimethylbicyclo[2.2.1]heptan-2-one--phenol (1/1)
| Molecular Formula | C16H22O2 |
|---|---|
| Molecular Weight | 246.16199 g/mol |
| LogP | 3.7939 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 0 |
| Exact Mass | 246.16199 |
| Monoisotopic Mass | 246.16199 |
| Heavy Atoms | 18 |
| Complexity | 263.0 |
Chemical Identifiers
| CAS Number | 37262-59-2 |
|---|---|
| SMILES | CC1(C2CCC1(C(=O)C2)C)C.C1=CC=C(C=C1)O |
| InChIKey | LKTOWUZQHJSGAK-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Camphorated phenol (CAS 37262-59-2), with molecular formula C16H22O2 and molecular weight 246.16199 g/mol. IUPAC: phenol;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.