![5,7-Diethyl-2-(3-nitro-phenyl)-1,3-diaza-tricyclo[3.3.1.1*3,7*]decan-6-one structure](/static/products/373/373372-96-4.png)
5,7-Diethyl-2-(3-nitro-phenyl)-1,3-diaza-tricyclo[3.3.1.1*3,7*]decan-6-one
5,7-diethyl-2-(3-nitrophenyl)-1,3-diazatricyclo[3.3.1.13,7]decan-6-one
Also Known As: Oprea1_666612|Oprea1_805357|BAS 01913993|5,7-Diethyl-2-(3-nitro-phenyl)-1,3-diaza-tricyclo[3.3.1.1*3,7*]decan-6-one|5,7-diethyl-2-(3-nitrophenyl)-1,3-diazatricyclo[3.3.1.13,7]decan-6-one|5,7-diethyl-2-(3-nitrophenyl)-1,3-diazatricyclo[3.3.1.1~3,7~]decan-6-one|(1r,3r,5r,7r)-5,7-diethyl-2-(3-nitrophenyl)-1,3-diazaadamantan-6-one|1,3-diethyl-6-(3-nitrophenyl)-5,7-diazatricyclo[3.3.1.1<3,7>]decan-2-one
| Molecular Formula | C18H23N3O3 |
|---|---|
| Molecular Weight | 329.17395 g/mol |
| LogP | 2.3 |
| Topological Polar Surface Area | 69.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 329.17395 |
| Monoisotopic Mass | 329.17395 |
| Heavy Atoms | 24 |
| Complexity | 516.0 |
Chemical Identifiers
| CAS Number | 373372-96-4 |
|---|---|
| SMILES | CCC12CN3CC(C1=O)(CN(C2)C3C4=CC(=CC=C4)[N+](=O)[O-])CC |
| InChIKey | JYHPUOCPSUAKRU-UHFFFAOYSA-N |
Product Overview
5,7-Diethyl-2-(3-nitro-phenyl)-1,3-diaza-tricyclo[3.3.1.1*3,7*]decan-6-one (CAS 373372-96-4), with molecular formula C18H23N3O3 and molecular weight 329.17395 g/mol. IUPAC: 5,7-diethyl-2-(3-nitrophenyl)-1,3-diazatricyclo[3.3.1.13,7]decan-6-one.
5,7-Diethyl-2-(3-nitro-phenyl)-1,3-diaza-tricyclo[3.3.1.1*3,7*]decan-6-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »