Phosphorane, triphenyl((trimethylsilyl)methylene)-
triphenyl(trimethylsilylmethylidene)-λ5-phosphane
Also Known As: Phosphorane, triphenyl((trimethylsilyl)methylene)-|triphenyl(trimethylsilylmethylidene)-|Triphenyl(trimethylsilylmethylene)phosphorane|Phosphorane,triphenyl[(trimethylsilyl)methylene]-|(Triphenylphosphonio)(trimethylsilyl)methanide|[(Trimethylsilyl)methylene]triphenylphosphorane|J1.640.826C|(Triphenylphosphonio)-(trimethylsilyl)methanide|Triphenylphosphoranylidene(trimethylsilyl)methane|Triphenyl[(trimethylsilyl)methylidene]-lambda~5~-phosphane
| Molecular Formula | C22H25PSi |
|---|---|
| Molecular Weight | 348.1463 g/mol |
| LogP | 4.6601 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 4 |
| Exact Mass | 348.1463 |
| Monoisotopic Mass | 348.1463 |
| Heavy Atoms | 24 |
| Complexity | 377.0 |
Chemical Identifiers
| CAS Number | 3739-97-7 |
|---|---|
| SMILES | C[Si](C)(C)C=P(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChIKey | ISHNXDLSMXSZLD-UHFFFAOYSA-N |
Product Overview
Phosphorane, triphenyl((trimethylsilyl)methylene)- (CAS 3739-97-7), with molecular formula C22H25PSi and molecular weight 348.1463 g/mol. IUPAC: triphenyl(trimethylsilylmethylidene)-λ5-phosphane.
Phosphorane, triphenyl((trimethylsilyl)methylene)- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »