MLS000079967
2-[(E)-furan-2-ylmethylideneamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile
Also Known As: 2-(2-furanylmethylideneamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile|2-(2-furfurylideneamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile|2-(furan-2-ylmethylideneamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile|(E)-2-((furan-2-ylmethylene)amino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile|2-{[(E)-furan-2-ylmethylidene]amino}-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile
| Molecular Formula | C15H14N2OS |
|---|---|
| Molecular Weight | 270.08267 g/mol |
| LogP | 4.23228 |
| Topological Polar Surface Area | 49.29 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 270.08267 |
| Monoisotopic Mass | 270.08267 |
| Heavy Atoms | 19 |
| Complexity | 631.89496 |
Chemical Identifiers
| CAS Number | 374091-98-2 |
|---|---|
| SMILES | C1CCC2=C(CC1)SC(=C2C#N)/N=C/C3=CC=CO3 |
Product Overview
MLS000079967 (CAS 374091-98-2), with molecular formula C15H14N2OS and molecular weight 270.08267 g/mol. IUPAC: 2-[(E)-furan-2-ylmethylideneamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile.