alpha-Aceto-beta-vinyl-gamma-valerolactone
3-acetyl-4-ethenyl-5-methyloxolan-2-one
Also Known As: alpha-Aceto-beta-vinyl-gamma-valerolactone|3-Acetyl-4-ethylidene-5-methyl-2-furanone|3-acetyl-4-ethenyl-5-methyloxolan-2-one|3-acetyl-4-ethenyl-5-methyldihydrofuran-2(3h)-one|3-acetyl-5-methyl-4-vinyldihydrofuran-2(3H)-one|3-Acetyl-5-methyl-4-vinyl-dihydro-furan-2-on|3-acetyl-5-methyl-4-vinyl-dihydro-furan-2-one|.ALPHA.-ACETO-.BETA.-VINYL-.GAMMA.-VALEROLACTONE|3-ACETYL-4-ETHENYLDIHYDRO-5-METHYL-2(3H)-FURANONE|2(3H)-FURANONE, 3-ACETYL-4-ETHENYLDIHYDRO-5-METHYL-|4-Pentenoic acid, 2-acetyl-3-(1-hydroxyethyl)-, gamma-lactone
| Molecular Formula | C9H12O3 |
|---|---|
| Molecular Weight | 168.07864 g/mol |
| LogP | 1.1 |
| Topological Polar Surface Area | 43.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 168.07864 |
| Monoisotopic Mass | 168.07864 |
| Heavy Atoms | 12 |
| Complexity | 232.0 |
Chemical Identifiers
| CAS Number | 37467-41-7 |
|---|---|
| SMILES | CC1C(C(C(=O)O1)C(=O)C)C=C |
| InChIKey | VGUJJUUXBHDZFM-UHFFFAOYSA-N |
Product Overview
alpha-Aceto-beta-vinyl-gamma-valerolactone (CAS 37467-41-7), with molecular formula C9H12O3 and molecular weight 168.07864 g/mol. IUPAC: 3-acetyl-4-ethenyl-5-methyloxolan-2-one.
alpha-Aceto-beta-vinyl-gamma-valerolactone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »