3,4-Dichloro-2,2,3,4,4-pentafluorobutanoic acid
3,4-dichloro-2,2,3,4,4-pentafluorobutanoic acid
Also Known As: 3,4-Dichloropentafluorobutyric acid|3,4-dichloro-2,2,3,4,4-pentafluorobutanoic acid|C4HCl2F5O2|3,4-dichloroperfluorobutyric acid|pentafluoro-3,4-dichlorobutanoic acid|3,4-DICHLOROPENTAFLUOROBUTYRICACID|3,4-Dichloro-2,2,3,4,4-pentaflurobutyric acid|Butanoic acid,3,4-dichloro-2,2,3,4,4-pentafluoro-|3,4-Dichloro-2,2,3,4,4-pentafluorobutanic acid|3,4-Dichloro-2,2,3,4,4-pentafluorobutyric acid|3,4-dichloro-2,2,3,4,4-pentafluoro-butanoic acid|I04-0397
| Molecular Formula | C4HCl2F5O2 |
|---|---|
| Molecular Weight | 245.92737 g/mol |
| LogP | 2.7 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Exact Mass | 245.92737 |
| Monoisotopic Mass | 245.92737 |
| Heavy Atoms | 13 |
| Complexity | 233.0 |
Chemical Identifiers
| CAS Number | 375-07-5 |
|---|---|
| SMILES | C(=O)(C(C(C(F)(F)Cl)(F)Cl)(F)F)O |
| InChIKey | WVWCLNDERHVFSB-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
3,4-Dichloro-2,2,3,4,4-pentafluorobutanoic acid (CAS 375-07-5), with molecular formula C4HCl2F5O2 and molecular weight 245.92737 g/mol. IUPAC: 3,4-dichloro-2,2,3,4,4-pentafluorobutanoic acid.