5,6-Dimethoxy-1-methyl-1H-indole-2-carboxylic acid
5,6-dimethoxy-1-methylindole-2-carboxylic acid
Also Known As: 5,6-Dimethoxy-1-methyl-1H-indole-2-carboxylic acid|Heptafluorobutyrylamidine|5,6-dimethoxy-1-methylindole-2-carboxylic acid|BAS 10142188|J2.706.832D|5,6-dimethoxy-1-methyl-indole-2-carboxylic acid|5,6-Dimethoxy-1-methyl-1H-indole-2-carboxylicacid|SR-01000368634-1|1-Methyl-5,6-dimethoxy-1H-indole-2-carboxylic acid|1,2,3-Thiadiazole,2,5-dihydro-2,4,5-triphenyl-,1,1-dioxide
| Molecular Formula | C12H13NO4 |
|---|---|
| Molecular Weight | 235.08446 g/mol |
| LogP | 1.8937 |
| Topological Polar Surface Area | 60.69 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 235.08446 |
| Monoisotopic Mass | 235.08446 |
| Heavy Atoms | 17 |
| Complexity | 585.6934 |
Chemical Identifiers
| CAS Number | 375-19-9 |
|---|---|
| SMILES | CN1C2=CC(=C(C=C2C=C1C(=O)O)OC)OC |
Product Overview
5,6-Dimethoxy-1-methyl-1H-indole-2-carboxylic acid (CAS 375-19-9), with molecular formula C12H13NO4 and molecular weight 235.08446 g/mol. IUPAC: 5,6-dimethoxy-1-methylindole-2-carboxylic acid.
5,6-Dimethoxy-1-methyl-1H-indole-2-carboxylic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »