AC1MEUG0
13-methyl-3-phenacylsulfanyl-7-phenyl-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one
Also Known As: AJ-292/40706553|8-methyl-1-[(2-oxo-2-phenylethyl)sulfanyl]-4-phenyl-6,7,8,9-tetrahydro[1]benzothieno[3,2-e][1,2,4]triazolo[4,3-a]pyrimidin-5(4H)-one|8-methyl-1-((2-oxo-2-phenylethyl)thio)-4-phenyl-6,7,8,9-tetrahydrobenzo[4,5]thieno[3,2-e][1,2,4]triazolo[4,3-a]pyrimidin-5(4H)-one|13-methyl-3-phenacylsulfanyl-7-phenyl-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one
| Molecular Formula | C26H22N4O2S2 |
|---|---|
| Molecular Weight | 486.1184 g/mol |
| LogP | 5.1947 |
| Topological Polar Surface Area | 69.26 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Exact Mass | 486.1184 |
| Monoisotopic Mass | 486.1184 |
| Heavy Atoms | 34 |
| Complexity | 1585.9701 |
Chemical Identifiers
| CAS Number | 375362-38-2 |
|---|---|
| SMILES | CC1CCC2=C(C1)SC3=C2C(=O)N(C4=NN=C(N34)SCC(=O)C5=CC=CC=C5)C6=CC=CC=C6 |
Product Overview
AC1MEUG0 (CAS 375362-38-2), with molecular formula C26H22N4O2S2 and molecular weight 486.1184 g/mol. IUPAC: 13-methyl-3-phenacylsulfanyl-7-phenyl-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one.