Naphthalen-1-ylmethanediyl diacetate
[acetyloxy(naphthalen-1-yl)methyl] acetate
Also Known As: naphthalen-1-ylmethanediyl diacetate|1-naphthylmethanediol diacetate|(1-Naphthyl)methylenediacetate|1-(Diacetoxymethyl)naphthalene|1-Naphthaldehyde diacetyl acetal|(1-Naphthyl)methanediol diacetate|[acetyloxy(naphthalen-1-yl)methyl] acetate|(Naphthalen-1-yl)methylene diacetate|Diacetic acid 1-naphthylmethylene ester|(acetyloxy-naphthalen-1-ylmethyl) acetate|Diacetic acid (1-naphthyl)methylene ester|Diacetic acid (1-naphthylmethylene) ester|Naphthalene-1-carbaldehyde diacetyl acetal|Bisacetic acid (1-naphthyl)methylene ester|(acetyloxy)(naphthalen-1-yl)methyl acetate|Methanediol,1-(1-naphthalenyl)-, 1,1-diacetate
| Molecular Formula | C15H14O4 |
|---|---|
| Molecular Weight | 258.0892 g/mol |
| LogP | 2.9 |
| Topological Polar Surface Area | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 258.0892 |
| Monoisotopic Mass | 258.0892 |
| Heavy Atoms | 19 |
| Complexity | 323.0 |
Chemical Identifiers
| CAS Number | 37587-86-3 |
|---|---|
| SMILES | CC(=O)OC(C1=CC=CC2=CC=CC=C21)OC(=O)C |
| InChIKey | SVDYJLYOWDIMEN-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Naphthalen-1-ylmethanediyl diacetate (CAS 37587-86-3), with molecular formula C15H14O4 and molecular weight 258.0892 g/mol. IUPAC: [acetyloxy(naphthalen-1-yl)methyl] acetate.