Benzamide, 2,4-dinitro-5-((p-(ethyl(2-iodoethyl)amino)benzyl)amino)-
5-[[4-[ethyl(2-iodoethyl)amino]phenyl]methylamino]-2,4-dinitrobenzamide
Also Known As: 2,4-Dinitro-5-((p-(ethyl(2-iodoethyl)amino)benzyl)amino)benzamide|5-({4-[ethyl(2-iodoethyl)amino]benzyl}amino)-2,4-dinitrobenzamide|Benzamide, 2,4-dinitro-5-((p-(ethyl(2-iodoethyl)amino)benzyl)amino)-|1-methyl-2-oxo-2,3-dihydro-indole-3-carboxylic acid anilide|5-[[4-[ethyl(2-iodoethyl)amino]phenyl]methylamino]-2,4-dinitrobenzamide|5-[({4-[Ethyl(2-iodoethyl)amino]phenyl}methyl)amino]-2,4-dinitrobenzene-1-carboximidic acid
| Molecular Formula | C18H20IN5O5 |
|---|---|
| Molecular Weight | 513.0509 g/mol |
| LogP | 4.1 |
| Topological Polar Surface Area | 150.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Exact Mass | 513.0509 |
| Monoisotopic Mass | 513.0509 |
| Heavy Atoms | 29 |
| Complexity | 576.0 |
Chemical Identifiers
| CAS Number | 37752-30-0 |
|---|---|
| SMILES | CCN(CCI)C1=CC=C(C=C1)CNC2=C(C=C(C(=C2)C(=O)N)[N+](=O)[O-])[N+](=O)[O-] |
| InChIKey | ZGEDRYNLSZDOHJ-UHFFFAOYSA-N |
Product Overview
Benzamide, 2,4-dinitro-5-((p-(ethyl(2-iodoethyl)amino)benzyl)amino)- (CAS 37752-30-0), with molecular formula C18H20IN5O5 and molecular weight 513.0509 g/mol. IUPAC: 5-[[4-[ethyl(2-iodoethyl)amino]phenyl]methylamino]-2,4-dinitrobenzamide.
Benzamide, 2,4-dinitro-5-((p-(ethyl(2-iodoethyl)amino)benzyl)amino)- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »