Phenylalanylphenylalanine methyl ester
methyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoate
Also Known As: Phe-phe-ome|Phenylalanylphenylalanine methyl ester|L-Phe-L-Phe-COOMe|methyl L-phenylalanyl-L-phenylalaninate|NH2-Phe(1)-Phe(2)-COOMe|methyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoate|L-Phenylalanine, N-L-phenylalanyl-, methyl ester|2-(2-Amino-3-phenyl-propionylamino)-3-phenyl-propionic acid methyl ester|L-Phenylalanine,L-phenylalanyl-, methyl ester, hydrochloride (1:1)|2-Amino-N-(1-methoxy-1-oxo-3-phenylpropan-2-yl)-3-phenylpropanimidic acid|(2S)-2-Amino-N-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-3-phenylpropanimidic acid|METHYL (2S)-2-[(2S)-2-AMINO-3-PHENYLPROPANAMIDO]-3-PHENYLPROPANOATE
| Molecular Formula | C19H22N2O3 |
|---|---|
| Molecular Weight | 326.16306 g/mol |
| LogP | 1.8 |
| Topological Polar Surface Area | 81.4 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Exact Mass | 326.16306 |
| Monoisotopic Mass | 326.16306 |
| Heavy Atoms | 24 |
| Complexity | 401.0 |
Chemical Identifiers
| CAS Number | 38017-65-1 |
|---|---|
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC2=CC=CC=C2)N |
| InChIKey | FBKRSZZALAQRNH-IRXDYDNUSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Phenylalanylphenylalanine methyl ester (CAS 38017-65-1), with molecular formula C19H22N2O3 and molecular weight 326.16306 g/mol. IUPAC: methyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoate.