4-Methoxy-4'-methylbenzhydrol
(4-methoxyphenyl)-(4-methylphenyl)methanol
Also Known As: 4-Methoxy-4'-methylbenzhydrol|(4-methoxyphenyl)-(4-methylphenyl)methanol|4-Methoxy-4 -methylbenzhydrol|4-Methyl-4 -methoxybenzhydrol|(4-methoxyphenyl)-(p-tolyl)methanol|(4-methoxyphenyl)(4-methylphenyl)methanol|4-Methylphenyl 4-methoxyphenylmethanol|4-Methoxy-4 -methylbenzhydryl alcohol|(4-Methylphenyl)(4-methoxyphenyl)methanol|4-Methoxy-a-(4-methylphenyl)benzenemethanol|Sulfone,4-fluoro-3-nitrophenyl m-nitrophenyl|4-Methoxy-|A-(4-methylphenyl)benzenemethanol|4-METHOXY-ALPHA-(4-METHYLPHENYL)BENZENEMETHANOL|J1.421.577H
| Molecular Formula | C15H16O2 |
|---|---|
| Molecular Weight | 228.11504 g/mol |
| LogP | 3.5 |
| Topological Polar Surface Area | 29.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 228.11504 |
| Monoisotopic Mass | 228.11504 |
| Heavy Atoms | 17 |
| Complexity | 213.0 |
Chemical Identifiers
| CAS Number | 383-22-2 |
|---|---|
| SMILES | CC1=CC=C(C=C1)C(C2=CC=C(C=C2)OC)O |
| InChIKey | STWAGNDOTLFTSV-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-Methoxy-4'-methylbenzhydrol (CAS 383-22-2), with molecular formula C15H16O2 and molecular weight 228.11504 g/mol. IUPAC: (4-methoxyphenyl)-(4-methylphenyl)methanol.