Benzamide, N-(2,4-dimethylphenyl)-2-hydroxy-3-nitro-
N-(2,4-dimethylphenyl)-2-hydroxy-3-nitrobenzamide
Also Known As: NCIMech_000441|3-Nitro-2',4'-salicyloxylidide|2',4'-Salicyloxylidide, 3-nitro-|n-(2,4-dimethylphenyl)-2-hydroxy-3-nitrobenzamide|Benzamide, N-(2,4-dimethylphenyl)-2-hydroxy-3-nitro-|WR 25818|2',4'-Dimethyl-3-nitrosalicylanilide|NCI60_041752|Benzamide, N- (2,4-dimethylphenyl)-2-hydroxy-3-nitro-|J1.582.218J|Benzamide,4-dimethylphenyl)-2-hydroxy-3-nitro-|N-(2,4-dimethylphenyl)-2-hydroxy-3-nitro-benzamide|N-(2,4-Dimethylphenyl)-2-hydroxy-3-nitrobenzene-1-carboximidic acid
| Molecular Formula | C15H14N2O4 |
|---|---|
| Molecular Weight | 286.09537 g/mol |
| LogP | 3.5 |
| Topological Polar Surface Area | 95.2 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 286.09537 |
| Monoisotopic Mass | 286.09537 |
| Heavy Atoms | 21 |
| Complexity | 396.0 |
Chemical Identifiers
| CAS Number | 38342-01-7 |
|---|---|
| SMILES | CC1=CC(=C(C=C1)NC(=O)C2=C(C(=CC=C2)[N+](=O)[O-])O)C |
| InChIKey | CBRBNMYCBQPPAE-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Benzamide, N-(2,4-dimethylphenyl)-2-hydroxy-3-nitro- (CAS 38342-01-7), with molecular formula C15H14N2O4 and molecular weight 286.09537 g/mol. IUPAC: N-(2,4-dimethylphenyl)-2-hydroxy-3-nitrobenzamide.