(Z)-but-2-enedioic acid;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-methyloxirane
(Z)-but-2-enedioic acid;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-methyloxirane
Also Known As: Bisphenol A, propylene oxide, fumaric acid polymer|(C15-H16-O2.C4-H4-O4.C3-H6-O)x-|2-Butenedioic acid (2Z)-, polymer with 4,4'-(1-methylethylidene)bis(phenol) and methyloxirane|2-Butenedioic acid, (Z)-, 4,4'-(1-methylethylidene)bisphenol, methyloxirane polymer|2-Butenedioic acid (2Z)-, polymer with 4,4'-(1-methylethylidene)bis(phenol) and 2-methyloxirane|(Z)-but-2-enedioic acid; 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol; 2-methyloxirane|(Z)-but-2-enedioic acid;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-methyloxirane|2-Butenedioic acid (2Z)-, polymer with 4,4'-(1-methylethylidene)bis[phenol] and methyloxirane|2-Butenedioic acid (Z)-, polymer with 4,4'-(1-methylethylidene)bis[phenol] and methyloxirane
| Molecular Formula | C22H26O7 |
|---|---|
| Molecular Weight | 402.16785 g/mol |
| LogP | 3.5406 |
| Topological Polar Surface Area | 127.59 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 402.16785 |
| Monoisotopic Mass | 402.16785 |
| Heavy Atoms | 29 |
| Complexity | 753.7442 |
Chemical Identifiers
| CAS Number | 38355-75-8 |
|---|---|
| SMILES | CC1CO1.CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O.C(=C\C(=O)O)\C(=O)O |
Product Overview
(Z)-but-2-enedioic acid;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-methyloxirane (CAS 38355-75-8), with molecular formula C22H26O7 and molecular weight 402.16785 g/mol. IUPAC: (Z)-but-2-enedioic acid;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-methyloxirane.