2,3-Dibromohexafluoro-2-butene
(E)-2,3-dibromo-1,1,1,4,4,4-hexafluorobut-2-ene
Also Known As: 2,3-Dibromohexafluoro-2-butene|C4Br2F6|2,3-Dibromohexafluorobut-2-ene|2163AE|2,3-dibromo-1,1,1,4,4,4-hexafluorobut-2-ene|(E)-2,3-dibromo-1,1,1,4,4,4-hexafluorobut-2-ene|J1.305.465G|C-5965|2,3-Dibromo-1,1,1,4,4,4-hexafluoro-2-butene|2,3-dibromo-1,1,1,4,4,4-hexafluoro-but-2-ene|2-Butene,2,3-dibromo-1,1,1,4,4,4-hexafluoro-|I14-25889|(2E)-2,3-Dibromo-1,1,1,4,4,4-hexafluoro-2-butene|(2E)-2,3-dibromo-1,1,1,4,4,4-hexafluorobut-2-ene
| Molecular Formula | C4Br2F6 |
|---|---|
| Molecular Weight | 319.8271 g/mol |
| LogP | 4.1124 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 0 |
| Exact Mass | 319.8271 |
| Monoisotopic Mass | 321.82504 |
| Heavy Atoms | 12 |
| Complexity | 176.57408 |
Chemical Identifiers
| CAS Number | 384-51-0 |
|---|---|
| SMILES | C(=C(/C(F)(F)F)\Br)(\C(F)(F)F)/Br |
Product Overview
2,3-Dibromohexafluoro-2-butene (CAS 384-51-0), with molecular formula C4Br2F6 and molecular weight 319.8271 g/mol. IUPAC: (E)-2,3-dibromo-1,1,1,4,4,4-hexafluorobut-2-ene.
2,3-Dibromohexafluoro-2-butene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »