Trisilane, 1,1,1,2,2,3,3-heptamethyl-3-(1-naphthalenyl)-
[dimethyl(naphthalen-1-yl)silyl]-dimethyl-trimethylsilylsilane
Also Known As: heptamethyl-1-(1-naphthyl)trisilane|1-(Heptamethyltrisilane-1-yl)naphthalene|Trisilane, 1,1,1,2,2,3,3-heptamethyl-3-(1-naphthalenyl)-|J2.053.935F|1,1,1,2,2,3,3-heptamethyl-3-(naphthalen-1-yl)trisilane|Trisilane,1,1,1,2,2,3,3-heptamethyl-3-(1-naphthalenyl)-|1,1,1,2,2,3,3-Heptamethyl-3-(1-naphthyl)trisilane|[dimethyl(naphthalen-1-yl)silyl]-dimethyl-trimethylsilylsilane
| Molecular Formula | C17H28Si3 |
|---|---|
| Molecular Weight | 316.14987 g/mol |
| LogP | 4.9586 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 3 |
| Exact Mass | 316.14987 |
| Monoisotopic Mass | 316.14987 |
| Heavy Atoms | 20 |
| Complexity | 341.0 |
Chemical Identifiers
| CAS Number | 38446-42-3 |
|---|---|
| SMILES | C[Si](C)(C)[Si](C)(C)[Si](C)(C)C1=CC=CC2=CC=CC=C21 |
| InChIKey | QMUHOVBKQKHWOD-UHFFFAOYSA-N |
Product Overview
Trisilane, 1,1,1,2,2,3,3-heptamethyl-3-(1-naphthalenyl)- (CAS 38446-42-3), with molecular formula C17H28Si3 and molecular weight 316.14987 g/mol. IUPAC: [dimethyl(naphthalen-1-yl)silyl]-dimethyl-trimethylsilylsilane.
Trisilane, 1,1,1,2,2,3,3-heptamethyl-3-(1-naphthalenyl)- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »