(2E)-3-(1-methyl-1H-indol-3-yl)-1-phenylprop-2-en-1-one
(E)-3-(1-methylindol-3-yl)-1-phenylprop-2-en-1-one
Also Known As: (2E)-3-(1-methyl-1H-indol-3-yl)-1-phenylprop-2-en-1-one|(E)-3-(1-methylindol-3-yl)-1-phenylprop-2-en-1-one|J1.956.099F|(E)-3-(1-Methyl-1H-indol-3-yl)-1-phenyl-propenone|(E)-3-(1-methyl-1H-indol-3-yl)-1-phenylprop-2-en-1-one|(E)-3-(1-methyl-3-indolyl)-1-phenyl-2-propen-1-one|F1305-0188|(2E)-3-(1-methylindol-3-yl)-1-phenylprop-2-en-1-one|(E)-3-(1-methylindol-3-yl)-1-phenyl-prop-2-en-1-one|(E)-1-Phenyl-3-(1-methyl-1H-indole-3-yl)-2-propene-1-one
| Molecular Formula | C18H15NO |
|---|---|
| Molecular Weight | 261.11536 g/mol |
| LogP | 4.0744 |
| Topological Polar Surface Area | 22.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 261.11536 |
| Monoisotopic Mass | 261.11536 |
| Heavy Atoms | 20 |
| Complexity | 781.5433 |
Chemical Identifiers
| CAS Number | 38470-65-4 |
|---|---|
| SMILES | CN1C=C(C2=CC=CC=C21)/C=C/C(=O)C3=CC=CC=C3 |
Product Overview
(2E)-3-(1-methyl-1H-indol-3-yl)-1-phenylprop-2-en-1-one (CAS 38470-65-4), with molecular formula C18H15NO and molecular weight 261.11536 g/mol. IUPAC: (E)-3-(1-methylindol-3-yl)-1-phenylprop-2-en-1-one.
(2E)-3-(1-methyl-1H-indol-3-yl)-1-phenylprop-2-en-1-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »