4,4'-Sulfonylbis(N,N-dimethylbenzenamine)
4-[4-(dimethylamino)phenyl]sulfonyl-N,N-dimethylaniline
Also Known As: DAD-sulfone|4,4'-bis sulfone|4,4'-Sulfonylbis(N,N-dimethylbenzenamine)|4,4'-Bis(dimethylaminodiphenyl)sulfone|4,4'-Bis-dimethylaminodiphenyl sulfone|4,4'-sulfonylbis(n,n-dimethylaniline)|4,4'-dimethylaminophenyl sulfone|Bis<(N,N-dimethylamino)phenyl> sulfone|Benzenamine, 4,4'-sulfonylbis(N,N-dimethyl-|4,4 -Sulfonylbis(N,N-dimethylaniline)|3-13-00-01253 (Beilstein Handbook Reference)|4-[4-(dimethylamino)phenyl]sulfonyl-N,N-dimethylaniline|4-(4-dimethylaminophenyl)sulfonyl-N,N-dimethylaniline|4-[4-(DIMETHYLAMINO)BENZENESULFONYL]-N,N-DIMETHYLANILINE
| Molecular Formula | C16H20N2O2S |
|---|---|
| Molecular Weight | 304.12454 g/mol |
| LogP | 2.8 |
| Topological Polar Surface Area | 49.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 304.12454 |
| Monoisotopic Mass | 304.12454 |
| Heavy Atoms | 21 |
| Complexity | 378.0 |
Chemical Identifiers
| CAS Number | 38580-22-2 |
|---|---|
| SMILES | CN(C)C1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)N(C)C |
| InChIKey | PLJHQVSJDMKAFP-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4,4'-Sulfonylbis(N,N-dimethylbenzenamine) (CAS 38580-22-2), with molecular formula C16H20N2O2S and molecular weight 304.12454 g/mol. IUPAC: 4-[4-(dimethylamino)phenyl]sulfonyl-N,N-dimethylaniline.