1,1-Bis(phenylsulfonyl)ethylene
1-(benzenesulfonyl)ethenylsulfonylbenzene
Also Known As: 1,1-Bis(phenylsulfonyl)ethylene|(Ethene-1,1-diyldisulfonyl)dibenzene|starbld0018408|ACMC-1AFRW|1-(benzenesulfonyl)ethenylsulfonylbenzene|CBDivE_004389|Vinylidenebis(phenyl sulfone)|trans(bisbenzenesulfonyl)ethene|1,1-Bis(phenylsulfonyl)ethene|Ethenylidenebis(phenyl sulfone)|1,1-bis(benzenesulfonyl)ethylene|1,1-Ethenediylbis(phenyl sulfone)|1,1-Ethenediylbissulfonylbisbenzene|Benzene, 1,1'-[ethenylidenebis(sulfonyl)]bis-|METHYL2-IODO-3-NITROBENZOATE|[1-(BENZENESULFONYL)ETHENESULFONYL]BENZENE|1,1'-(ethene-1,1-diyldisulfonyl)dibenzene|1,1-Bis(phenylsulfonyl)ethylene, >=98.0% (CH)
| Molecular Formula | C14H12O4S2 |
|---|---|
| Molecular Weight | 308.0177 g/mol |
| LogP | 2.7 |
| Topological Polar Surface Area | 85.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 308.0177 |
| Monoisotopic Mass | 308.0177 |
| Heavy Atoms | 20 |
| Complexity | 487.0 |
Chemical Identifiers
| CAS Number | 39082-53-6 |
|---|---|
| SMILES | C=C(S(=O)(=O)C1=CC=CC=C1)S(=O)(=O)C2=CC=CC=C2 |
| InChIKey | KABQEPJVQFXVIN-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1,1-Bis(phenylsulfonyl)ethylene (CAS 39082-53-6), with molecular formula C14H12O4S2 and molecular weight 308.0177 g/mol. IUPAC: 1-(benzenesulfonyl)ethenylsulfonylbenzene.