N-(4-Bromobenzylidene)-p-toluidine
1-(4-bromophenyl)-N-(4-methylphenyl)methanimine
Also Known As: N-(4-Bromobenzylidene)-p-toluidine|N-(4-bromobenzylidene)-4-methylaniline|N-(p-Bromobenzylidene)-4-methylaniline|N-(p-Bromobenzylidene)-p-methylaniline|p-bromobenzylidene-(4-methylphenyl)-amine|N-[(4-Bromophenyl)methylidene]-4-methylaniline|1-(4-bromophenyl)-N-(4-methylphenyl)methanimine|J1.064.591C|N-(4-Methylphenyl)-4-bromobenzenemethaneimine|Benzenamine,N-(4-bromophenyl)methylene-4-methyl-|Benzenamine, N-[(4-bromophenyl)methylene]-4-methyl-|N-[(E)-(4-Bromophenyl)methylidene]-4-methylaniline
| Molecular Formula | C14H12BrN |
|---|---|
| Molecular Weight | 273.01532 g/mol |
| LogP | 4.3 |
| Topological Polar Surface Area | 12.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 273.01532 |
| Monoisotopic Mass | 273.01532 |
| Heavy Atoms | 16 |
| Complexity | 223.0 |
Chemical Identifiers
| CAS Number | 39128-27-3 |
|---|---|
| SMILES | CC1=CC=C(C=C1)N=CC2=CC=C(C=C2)Br |
| InChIKey | JDEZSMCWSDUUAM-UHFFFAOYSA-N |
Product Overview
N-(4-Bromobenzylidene)-p-toluidine (CAS 39128-27-3), with molecular formula C14H12BrN and molecular weight 273.01532 g/mol. IUPAC: 1-(4-bromophenyl)-N-(4-methylphenyl)methanimine.
N-(4-Bromobenzylidene)-p-toluidine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »