Ethyl (2S)-2-amino-3-(4-fluorophenyl)propanoate
ethyl (2S)-2-amino-3-(4-fluorophenyl)propanoate
Also Known As: Ethyl 4-fluoro-L-phenylalaninate|4-fluorophenylalanine ethyl ester|ETHYL (2S)-2-AMINO-3-(4-FLUOROPHENYL)PROPANOATE|-2-Amino-3- propionicacidethylester|DL-4-fluorophenylalanine ethyl ester|L-Phenylalanine,4-fluoro-, ethyl ester|L-Phenylalanine, 4-fluoro-, ethyl ester|(S)-2-(4-Fluorobenzyl)glycine ethyl ester|Ethyl (S)-2-amino-3-(4-fluorophenyl)propanoate|Ethyl 2-amino-3-(4-fluorophenyl)propanoate|J2.554.827B|(S)-2-AMINO-3-(4-FLUOROPHENYL)PROPANOIC ACID ETHYL ESTER|(S)-2-Amino-3-(4-fluorophenyl)propionicacidethylester
| Molecular Formula | C11H14FNO2 |
|---|---|
| Molecular Weight | 211.10086 g/mol |
| LogP | 1.2586 |
| Topological Polar Surface Area | 52.32 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 211.10086 |
| Monoisotopic Mass | 211.10086 |
| Heavy Atoms | 15 |
| Complexity | 323.86475 |
Chemical Identifiers
| CAS Number | 39256-83-2 |
|---|---|
| SMILES | CCOC(=O)[C@H](CC1=CC=C(C=C1)F)N |
Product Overview
Ethyl (2S)-2-amino-3-(4-fluorophenyl)propanoate (CAS 39256-83-2), with molecular formula C11H14FNO2 and molecular weight 211.10086 g/mol. IUPAC: ethyl (2S)-2-amino-3-(4-fluorophenyl)propanoate.