5,5-Dimethyl-2-phenyl-1,2,4-triazolidine-3-thione
5,5-dimethyl-2-phenyl-1,2,4-triazolidine-3-thione
Also Known As: 5,5-dimethyl-2-phenyl-1,2,4-triazolidine-3-thione|Maybridge4_000703|CBMicro_020166|5,5-dimethyl-2-phenyl-1,2,4-triazolane-3-thione|CCG-8121|KS-000021SL|BAS 00395388|IDI1_031285|NCGC00177289-01|BIM-0020259.P001|9W-0848|SR-01000500462-1|5,5-Dimethyl-2-phenyl-[1,2,4]triazolidine-3-thione|BRD-K57270499-001-01-2|1,2,4-Triazolidine-3-thione, 5,5-dimethyl-2-phenyl-|2-Phenyl-5,5-dimethyltetrahydro-3H-1,2,4-triazole-3-thione
| Molecular Formula | C10H13N3S |
|---|---|
| Molecular Weight | 207.08302 g/mol |
| LogP | 2.0 |
| Topological Polar Surface Area | 59.4 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 207.08302 |
| Monoisotopic Mass | 207.08302 |
| Heavy Atoms | 14 |
| Complexity | 234.0 |
Chemical Identifiers
| CAS Number | 39263-68-8 |
|---|---|
| SMILES | CC1(NC(=S)N(N1)C2=CC=CC=C2)C |
| InChIKey | IEGNHJAOYPHKHE-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
5,5-Dimethyl-2-phenyl-1,2,4-triazolidine-3-thione (CAS 39263-68-8), with molecular formula C10H13N3S and molecular weight 207.08302 g/mol. IUPAC: 5,5-dimethyl-2-phenyl-1,2,4-triazolidine-3-thione.