(S)-2-((S)-2-Amino-3-methylbutanamido)-4-methylpentanoic acid
2-[(2-amino-3-methylbutanoyl)amino]-4-methylpentanoic acid
Also Known As: Valylleucine|Val-Leu|H-Val-Leu-OH|N-L-Valyl-L-leucine|d,l-valyl-d,l-leucine|Leucine, N-L-valyl-, D-(8CI)|EINECS 223-634-1|(S)-2-((S)-2-Amino-3-methylbutanamido)-4-methylpentanoic acid|2-(2-Amino-3-methyl-butyrylamino)-4-methyl-pentanoic acid|2-[(2-amino-3-methylbutanoyl)amino]-4-methylpentanoic acid|5-AMINO-1,2,3-THIADIAZOLE-4-CARBOXYLICACIDETHYLESTER|(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoic acid|Vl
| Molecular Formula | C11H22N2O3 |
|---|---|
| Molecular Weight | 230.16304 g/mol |
| LogP | -2.1 |
| Topological Polar Surface Area | 92.4 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Exact Mass | 230.16304 |
| Monoisotopic Mass | 230.16304 |
| Heavy Atoms | 16 |
| Complexity | 252.0 |
Chemical Identifiers
| CAS Number | 3929-62-2 |
|---|---|
| SMILES | CC(C)CC(C(=O)O)NC(=O)C(C(C)C)N |
| InChIKey | XCTHZFGSVQBHBW-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(S)-2-((S)-2-Amino-3-methylbutanamido)-4-methylpentanoic acid (CAS 3929-62-2), with molecular formula C11H22N2O3 and molecular weight 230.16304 g/mol. IUPAC: 2-[(2-amino-3-methylbutanoyl)amino]-4-methylpentanoic acid.