1,4-Bis(methylsulfonylsulfanylmethyl)benzene
1,4-bis(methylsulfonylsulfanylmethyl)benzene
Also Known As: 1,4-bis(methylsulfonylsulfanylmethyl)benzene|alpha,alpha'-Paraxylyl Bismethanethiosulfonate|a,a'-Paraxylyl Bismethanethiosulfonate|?,?'-Paraxylyl Bismethanethiosulfonate||A,|A'-Paraxylyl Bismethanethiosulfonate|p-Xylene-|A,|A'-dithiol Dimethanesulfonate|Alpha,Alpha`-Paraxylyl Bismethanethiosulfonate|?+/-,?+/-a?-Paraxylyl Bismethanethiosulfonate|alpha , alpha '-Paraxylyl Bismethanethiosulfonate|Thio-methanesulfonic Acid S,S'-p-Phenylenedimethylene Ester|S,S'-[1,4-Phenylenebis(methylene)] dimethanesulfonothioate|a,a inverted exclamation mark -Paraxylyl Bismethanethiosulfonate||A,|A inverted exclamation mark -Paraxylyl Bismethanethiosulfonate
| Molecular Formula | C10H14O4S4 |
|---|---|
| Molecular Weight | 325.9775 g/mol |
| LogP | 2.0722 |
| Topological Polar Surface Area | 68.28 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Exact Mass | 325.9775 |
| Monoisotopic Mass | 325.9775 |
| Heavy Atoms | 18 |
| Complexity | 532.2698 |
Chemical Identifiers
| CAS Number | 3948-46-7 |
|---|---|
| SMILES | CS(=O)(=O)SCC1=CC=C(C=C1)CSS(=O)(=O)C |
Product Overview
1,4-Bis(methylsulfonylsulfanylmethyl)benzene (CAS 3948-46-7), with molecular formula C10H14O4S4 and molecular weight 325.9775 g/mol. IUPAC: 1,4-bis(methylsulfonylsulfanylmethyl)benzene.