Guanosine, 6-O-ethyl-
(2R,3R,4S,5R)-2-(2-amino-6-ethoxypurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
Also Known As: 6-O-Ethylguanosine|Guanosine, 6-O-ethyl-|o6-ethylguanosine|(2R,3R,4S,5R)-2-(2-amino-6-ethoxypurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol|6-Ethoxy-9-pentofuranosyl-3,9-dihydro-2H-purin-2-imine|6-Ethoxy-9-beta-D-ribofuranosyl-3,9-dihydro-2H-purin-2-imine|(2R,3R,4S,5R)-2-(2-Amino-6-ethoxy-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol|(2R,3R,4S,5R)-2-(2-amino-6-ethoxy-9H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
| Molecular Formula | C12H17N5O5 |
|---|---|
| Molecular Weight | 311.12296 g/mol |
| LogP | -0.4 |
| Topological Polar Surface Area | 149.0 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Exact Mass | 311.12296 |
| Monoisotopic Mass | 311.12296 |
| Heavy Atoms | 22 |
| Complexity | 391.0 |
Chemical Identifiers
| CAS Number | 39708-01-5 |
|---|---|
| SMILES | CCOC1=NC(=NC2=C1N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N |
| InChIKey | YZMNBCLMSGJHTI-IOSLPCCCSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Guanosine, 6-O-ethyl- (CAS 39708-01-5), with molecular formula C12H17N5O5 and molecular weight 311.12296 g/mol. IUPAC: (2R,3R,4S,5R)-2-(2-amino-6-ethoxypurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.