1,1,1-Trifluoro-3-phenyl-2-propanone
1,1,1-trifluoro-3-phenylpropan-2-one
Also Known As: 1,1,1-trifluoro-3-phenylpropan-2-one|3-Phenyl-1,1,1-Trifluoropropan-2-One|1,1,1-trifluoro-3-phenylacetone|1,1,1-Trifluoro-3-phenyl-2-propanone|ACMC-20amz1|Trifluoromethylbenzyl ketone|benzyl trifluoromethyl ketone|trifluoromethyl benzyl ketone|3-Phenyl-1,1,1-trifluoroacetone|Benzyl(trifluoromethyl) ketone|Trifluoromethyl(benzyl) ketone|Phenyl-1-hydroxy-2-naphthoate|1,1,1-Trifluoro-3-phenyl-propan-2-one|KST-1B3929|1,1,1-trifluoro-3-phenylpropanone|2-Propanone, 1,1,1-trifluoro-3-phenyl-|1-Phenyl-3,3,3-trifluoropropane-2-one
| Molecular Formula | C9H7F3O |
|---|---|
| Molecular Weight | 188.0449 g/mol |
| LogP | 2.6 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 188.0449 |
| Monoisotopic Mass | 188.0449 |
| Heavy Atoms | 13 |
| Complexity | 180.0 |
Chemical Identifiers
| CAS Number | 39751-84-3 |
|---|---|
| SMILES | C1=CC=C(C=C1)CC(=O)C(F)(F)F |
| InChIKey | IAJKTOIWQHTZOS-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1,1,1-Trifluoro-3-phenyl-2-propanone (CAS 39751-84-3), with molecular formula C9H7F3O and molecular weight 188.0449 g/mol. IUPAC: 1,1,1-trifluoro-3-phenylpropan-2-one.