2,2,5,5-Tetramethyl-4-phenyl-2,5-dihydro-1H-imidazol-1-ol
1-hydroxy-2,2,5,5-tetramethyl-4-phenylimidazole
Also Known As: 1-Hydroxy-2,2,5,5-tetramethyl-4-phenyl-3-imidazoline|1-hydroxy-2,2,5,5-tetramethyl-4-phenylimidazole|2,2,5,5-Tetramethyl-4-phenyl-2,5-dihydro-1H-imidazol-1-ol|4-phenyl-2,2,5,5-tetramethyl-3-imidazolin-1-yloxy|1-HYDROXY-4-PHENYL-2,2,5,5-TETRAMETHYL-3-IMIDAZOLINE|2,2,5,5-tetramethyl-4-phenyl-3-imidazolin-1-ol|2,2,5,5-Tetramethyl-4-phenyl-2,5-dihydro-1H-imidazol-1-ol #|1H-Imidazole, 2,5-dihydro-1-hydroxy-2,2,5,5-tetramethyl-4-phenyl-
| Molecular Formula | C13H18N2O |
|---|---|
| Molecular Weight | 218.1419 g/mol |
| LogP | 2.2 |
| Topological Polar Surface Area | 35.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 218.1419 |
| Monoisotopic Mass | 218.1419 |
| Heavy Atoms | 16 |
| Complexity | 301.0 |
Chemical Identifiers
| CAS Number | 39753-69-0 |
|---|---|
| SMILES | CC1(C(=NC(N1O)(C)C)C2=CC=CC=C2)C |
| InChIKey | CVWOZKTYHKOFFX-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2,2,5,5-Tetramethyl-4-phenyl-2,5-dihydro-1H-imidazol-1-ol (CAS 39753-69-0), with molecular formula C13H18N2O and molecular weight 218.1419 g/mol. IUPAC: 1-hydroxy-2,2,5,5-tetramethyl-4-phenylimidazole.