Ethyl 3-aminobenzofuran-2-carboxylate
ethyl 3-amino-1-benzofuran-2-carboxylate
Also Known As: Ethyl 3-aminobenzofuran-2-carboxylate|ethyl 3-amino-1-benzofuran-2-carboxylate|Enamine_001390|Ethyl 3-Aminocoumarilate|ACMC-1CSW1|Aminobenzofuransaureathylester|Oprea1_566336|3-Aminocoumarilic Acid Ethyl Ester|KS-000011XT|ethyl 3-aminobenzo[b]furan-2-carboxylate|Ethyl-3-amino-1-benzofuran-2-carboxylate|BS-4156|2-Benzofurancarboxylic acid, 3-amino-, ethyl ester|3-Aminobenzofuran-2-carboxylic Acid Ethyl Ester|ethyl 2-(benzo[d]thiazol-2-yl)acetate|ETHYL3-AMINOBENZOFURAN-2-CARBOXYLATE|ethyl 3-amino-2-benzo[b]furancarboxylate|ethyl 3-aminobenzo[d]furan-2-carboxylate
| Molecular Formula | C11H11NO3 |
|---|---|
| Molecular Weight | 205.0739 g/mol |
| LogP | 2.1917 |
| Topological Polar Surface Area | 65.46 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 205.0739 |
| Monoisotopic Mass | 205.0739 |
| Heavy Atoms | 15 |
| Complexity | 501.50238 |
Chemical Identifiers
| CAS Number | 39786-35-1 |
|---|---|
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2O1)N |
Product Overview
Ethyl 3-aminobenzofuran-2-carboxylate (CAS 39786-35-1), with molecular formula C11H11NO3 and molecular weight 205.0739 g/mol. IUPAC: ethyl 3-amino-1-benzofuran-2-carboxylate.