3-Nitro-5-(trifluoromethyl)aniline
3-nitro-5-(trifluoromethyl)aniline
Also Known As: 3-nitro-5-(trifluoromethyl)aniline|3-Amino-5-nitrobenzotrifluoride|3-nitro-5-(trifluoromethyl)benzenamine|3-nitro-5-trifluoromethyl-phenylamine|3-amino-5-(trifluoromethyl)nitrobenzene|3-Nitro-5-trifluoromethylaniline|3-Amino-5-N-nitrobenzotrifluoride|3-(Trifluoromethyl)-5-nitroaniline|5-nitro-3-(trifluoromethyl)phenylamine|KS-000009RD|Benzenamine, 3-nitro-5-(trifluoromethyl)-|aniline, 3-nitro-5-trifluoromethyl-|3-nitro-5-(trifluoromethyl)phenylamine|CS-W002284|3-AMINO-5-NITRO BENZOTRIFLUORIDE|3-Nitro-5-(trifluoromethyl)aniline 98%|3-NTRO-5-(TRIFLROMETHL)ANIL 1G.|3-NTRO-5-(TRIFLROMETHL)ANI 10G.
| Molecular Formula | C7H5F3N2O2 |
|---|---|
| Molecular Weight | 206.03032 g/mol |
| LogP | 2.1958 |
| Topological Polar Surface Area | 69.16 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 206.03032 |
| Monoisotopic Mass | 206.03032 |
| Heavy Atoms | 14 |
| Complexity | 375.68793 |
Chemical Identifiers
| CAS Number | 401-94-5 |
|---|---|
| SMILES | C1=C(C=C(C=C1N)[N+](=O)[O-])C(F)(F)F |
Product Overview
3-Nitro-5-(trifluoromethyl)aniline (CAS 401-94-5), with molecular formula C7H5F3N2O2 and molecular weight 206.03032 g/mol. IUPAC: 3-nitro-5-(trifluoromethyl)aniline.
3-Nitro-5-(trifluoromethyl)aniline is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »