L-1-deoxyfluoroglycerol
bis(cyclohexanamine);(3-fluoro-2-hydroxypropyl) dihydrogen phosphate
Also Known As: L-1-deoxyfluoroglycerol|Sid 775356|cyclohexanamine 3-fluoro-2-hydroxypropyl phosphate|DL-1-Deoxyfluoroglycerol 3-phosphate dicyclohexylammonium salt|DL-3-Fluoro-1,2-propanediol 1-(dihydrogen phosphate) bis(cyclohexylammonium) salt|D-1-Deoxyfluoroglycerol 3-phosphate dicyclohexylammonium salt|L-1-Deoxyfluoroglycerol 3-phosphate dicyclohexylammonium salt|1,2-Propanediol, 3-fluoro-, 1-(dihydrogen phosphate), bis(cyclohexylammonium) salt, DL-|1-Deoxy-1-fluoro-sn-glycerol-3-phosphate dicyclohexylammonium salt|cyclohexanamine; (3-fluoro-2-hydroxypropyl) dihydrogen phosphate|1,2-Propanediol, 3-fluoro-, 1-(dihydrogen phosphate), bis(cyclohexylammonium) salt, D-|D-3-Fluoro-1,2-propanediol 1-(dihydrogen phosphate) bis(cyclohexylammonium) salt|L-3-Fluoro-1,2-propanediol 1-(dihydrogen phosphate) bis(cyclohexylammonium) salt|1,2-Propanediol, 3-fluoro-, 1-(dihydrogen phosphate), (S)-, compd. with cyclohexanamine (1:2)
| Molecular Formula | C15H34FN2O5P |
|---|---|
| Molecular Weight | 372.21893 g/mol |
| LogP | 1.9817 |
| Topological Polar Surface Area | 139.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Exact Mass | 372.21893 |
| Monoisotopic Mass | 372.21893 |
| Heavy Atoms | 24 |
| Complexity | 179.0 |
Chemical Identifiers
| CAS Number | 40147-96-4 |
|---|---|
| SMILES | C1CCC(CC1)N.C1CCC(CC1)N.C(C(CF)O)OP(=O)(O)O |
| InChIKey | FPNBGESKEFQWTJ-UHFFFAOYSA-N |
Product Overview
L-1-deoxyfluoroglycerol (CAS 40147-96-4), with molecular formula C15H34FN2O5P and molecular weight 372.21893 g/mol. IUPAC: bis(cyclohexanamine);(3-fluoro-2-hydroxypropyl) dihydrogen phosphate.