Benzyl 3,5-dimethyl-1H-pyrrole-2-carboxylate
benzyl 3,5-dimethyl-1H-pyrrole-2-carboxylate
Also Known As: Benzyl 3,5-dimethylpyrrole-2-carboxylate|Benzyl 3,5-dimethyl-1H-pyrrole-2-carboxylate|CB-1135|Benzyl3,5-dimethylpyrrole-2-carboxylate|I14-2752|5-(Benzyloxycarbonyl)-2,4-dimethyl-1H-pyrrole|(phenylmethyl) 3,5-dimethyl-1H-pyrrole-2-carboxylate|1H-Pyrrole-2-carboxylic acid, 3,5-dimethyl-, phenylmethyl ester|3,5-dimethyl-1H-pyrrole-2-carboxylic acid (phenylmethyl) ester|1H-Pyrrole-2-carboxylicacid, 3,5-dimethyl-, phenylmethyl ester|3,5-DIMETHYL-1H-PYRROLE-2-CARBOXYLIC ACID BENZYL ESTER|3,5-DIMETHYL-1H-PYRROLE-2-CARBOXYLIC ACID PHENYLMETHYL ESTER
| Molecular Formula | C14H15NO2 |
|---|---|
| Molecular Weight | 229.11028 g/mol |
| LogP | 2.98854 |
| Topological Polar Surface Area | 42.09 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 229.11028 |
| Monoisotopic Mass | 229.11028 |
| Heavy Atoms | 17 |
| Complexity | 514.27344 |
Chemical Identifiers
| CAS Number | 40236-19-9 |
|---|---|
| SMILES | CC1=CC(=C(N1)C(=O)OCC2=CC=CC=C2)C |
Product Overview
Benzyl 3,5-dimethyl-1H-pyrrole-2-carboxylate (CAS 40236-19-9), with molecular formula C14H15NO2 and molecular weight 229.11028 g/mol. IUPAC: benzyl 3,5-dimethyl-1H-pyrrole-2-carboxylate.