6-(2-Aminoethyl)amino-5-chlorouracil
6-(2-aminoethylamino)-5-chloro-1H-pyrimidine-2,4-dione
Also Known As: 6-(2-Aminoethyl)amino-5-chlorouracil|AEAC cpd|6-((2-Aminoethyl)amino)-5-chloropyrimidine-2,4(1H,3H)-dione|5-Chloro-6-(2-aminoethylamino)uracil|6-(2-aminoethylamino)-5-chloro-1H-pyrimidine-2,4-dione|6-(2-Aminoethylamino)-5-chlorouracil|6-(2-aminoethyl) amino-5-chlorouracil|6-[(2-aminoethyl)amino]-5-chloropyrimidine-2,4(1h,3h)-dione|J1.661.394K|2,4(1H,3H)-Pyrimidinedione, 6-[(2-aminoethyl)amino]-5-chloro-|2,3H)-Pyrimidinedione,6-[(2-aminoethyl)amino]-5-chloro-|6-[(2-aminoethyl)amino]-5-chloro-1,2,3,4-tetrahydropyrimidine-2,4-dione
| Molecular Formula | C6H9ClN4O2 |
|---|---|
| Molecular Weight | 204.0414 g/mol |
| LogP | -0.9 |
| Topological Polar Surface Area | 96.3 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 204.0414 |
| Monoisotopic Mass | 204.0414 |
| Heavy Atoms | 13 |
| Complexity | 276.0 |
Chemical Identifiers
| CAS Number | 40255-67-2 |
|---|---|
| SMILES | C(CNC1=C(C(=O)NC(=O)N1)Cl)N |
| InChIKey | UBIZYYDQUSJYIT-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
6-(2-Aminoethyl)amino-5-chlorouracil (CAS 40255-67-2), with molecular formula C6H9ClN4O2 and molecular weight 204.0414 g/mol. IUPAC: 6-(2-aminoethylamino)-5-chloro-1H-pyrimidine-2,4-dione.