N,N'-Bis(4-fluorophenyl)thiourea
1,3-bis(4-fluorophenyl)thiourea
Also Known As: 1,3-bis(4-fluorophenyl)thiourea|N,N'-Bis(4-fluorophenyl)thiourea|Di-4-fluorophenyl thiourea|4,4'-Difluorothiocarbanilide|Carbanilide,4'-difluorothio-|CCG-30|U 19963|1,3-Bis(p-fluorophenyl)thiourea|Thiourea,N'-bis(4-fluorophenyl)-|1,3-bis(4-fluorophenyl)isothiourea|1,3-bis-(4-fluoro-phenyl)-thiourea|Urea,3-bis(p-fluorophenyl)-2-thio-|N.N'-Bis-
| Molecular Formula | C13H10F2N2S |
|---|---|
| Molecular Weight | 264.05328 g/mol |
| LogP | 3.7737 |
| Topological Polar Surface Area | 24.06 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 264.05328 |
| Monoisotopic Mass | 264.05328 |
| Heavy Atoms | 18 |
| Complexity | 488.42264 |
Chemical Identifiers
| CAS Number | 404-52-4 |
|---|---|
| SMILES | C1=CC(=CC=C1NC(=S)NC2=CC=C(C=C2)F)F |
Product Overview
N,N'-Bis(4-fluorophenyl)thiourea (CAS 404-52-4), with molecular formula C13H10F2N2S and molecular weight 264.05328 g/mol. IUPAC: 1,3-bis(4-fluorophenyl)thiourea.