Tert-butyl 2-(1,3-dioxo-1,3-dihydro-2h-isoindol-2-yl)-3-oxopropanoate
tert-butyl 2-(1,3-dioxoisoindol-2-yl)-3-oxopropanoate
Also Known As: tert-butyl 2-formyl-2-phthalimido-acetate|tert-butyl 2-(1,3-dioxoisoindol-2-yl)-3-oxopropanoate|tert-butyl 2-(1,3-dioxo-1,3-dihydro-2h-isoindol-2-yl)-3-oxopropanoate|tert-butyl 2-(1,3-dioxoisoindolin-2-yl)-3-oxopropanoate|2H-Isoindole-2-aceticacid, a-formyl-1,3-dihydro-1,3-dioxo-,1,1-dimethylethyl ester|2H-Isoindole-2-aceticacid,a-formyl-1,3-dihydro-1,3-dioxo-,1,1-dimethylethyl ester
| Molecular Formula | C15H15NO5 |
|---|---|
| Molecular Weight | 289.09503 g/mol |
| LogP | 1.5 |
| Topological Polar Surface Area | 80.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 289.09503 |
| Monoisotopic Mass | 289.09503 |
| Heavy Atoms | 21 |
| Complexity | 455.0 |
Chemical Identifiers
| CAS Number | 40596-46-1 |
|---|---|
| SMILES | CC(C)(C)OC(=O)C(C=O)N1C(=O)C2=CC=CC=C2C1=O |
| InChIKey | AOUWUXDUCLLPTB-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Tert-butyl 2-(1,3-dioxo-1,3-dihydro-2h-isoindol-2-yl)-3-oxopropanoate (CAS 40596-46-1), with molecular formula C15H15NO5 and molecular weight 289.09503 g/mol. IUPAC: tert-butyl 2-(1,3-dioxoisoindol-2-yl)-3-oxopropanoate.