Oxifentorex
N-benzyl-N-methyl-1-phenylpropan-2-amine oxide
Also Known As: Oxifentorex|Oxifentorexum|Benzphetamine oxide|Oxifentorex [INN:DCF]|OXIFENTOREX [INN]|AMMONIUMHEXAFLUOROSILICATE|N-benzyl-N-methyl-1-phenylpropan-2-amine oxide|N-Benzyl-N,alpha-dimethylphenethylamine N-oxide|N-Benzyl-N,alpha-dimethylbenzeneethanamine oxide|N-Benzyl-N-methyl-1-phenylpropan-2-amine N-oxide|N-BENZYL-N-METHYL-1-PHENYLPROPANAMINE OXIDE|N-BENZYL-N,.ALPHA.-DIMETHYLPHENETHYLAMINE N-OXIDE|Phenethylamine, N-benzyl-N,.alpha.-dimethyl-, N-oxide|Benzeneethanamine, N,.alpha.-dimethyl-N-(phenylmethyl)-, N-oxide|N-BENZYL-N,.ALPHA.-DIMETHYLPHENETHYLAMINE N-OXIDE, (+/-)-
| Molecular Formula | C17H21NO |
|---|---|
| Molecular Weight | 255.16231 g/mol |
| LogP | 3.6 |
| Topological Polar Surface Area | 18.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Exact Mass | 255.16231 |
| Monoisotopic Mass | 255.16231 |
| Heavy Atoms | 19 |
| Complexity | 256.0 |
Chemical Identifiers
| CAS Number | 4075-88-1 |
|---|---|
| SMILES | CC(CC1=CC=CC=C1)[N+](C)(CC2=CC=CC=C2)[O-] |
| InChIKey | LXPCOISGJFXEJE-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Oxifentorex (CAS 4075-88-1), with molecular formula C17H21NO and molecular weight 255.16231 g/mol. IUPAC: N-benzyl-N-methyl-1-phenylpropan-2-amine oxide.