Methyl 3-Amino-4-chlorobenzoate
methyl 3-amino-4-chlorobenzoate
Also Known As: Methyl 3-amino-4-chlorobenzoate|3-Amino-4-chlorobenzoic Acid Methyl Ester|Intedanib Impurity 5|Nintedanib Impurity 67|ACMC-1AMTH|3-Amino-4-Chlorobenzoic Acid Methylester|methyl 3-amino-4-chloro-benzoate|IFLab1_001610|3-(4-Methylphenoxy)benzoicacid|benzoic acid, 3-amino-4-chloro-, methyl ester|KS-00000MGV|Methyl 4-chloro-3-aminobenzoate|2-Chloro-5-methoxycarbonylaniline|methyl 3-amino 4-chloro benzoate|Methyl 4-chloro-3-amino-benzoate|methyl-3-amino-4-chloro-benzoate|METHYL3-AMINO-4-CHLOROBENZOATE|CM-309|AC-1794|CS-W016934|PS-4115
| Molecular Formula | C8H8ClNO2 |
|---|---|
| Molecular Weight | 185.02435 g/mol |
| LogP | 2.1 |
| Topological Polar Surface Area | 52.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 185.02435 |
| Monoisotopic Mass | 185.02435 |
| Heavy Atoms | 12 |
| Complexity | 174.0 |
Chemical Identifiers
| CAS Number | 40872-87-5 |
|---|---|
| SMILES | COC(=O)C1=CC(=C(C=C1)Cl)N |
| InChIKey | LOCJPOYKBUUVKU-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 8 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Methyl 3-Amino-4-chlorobenzoate (CAS 40872-87-5), with molecular formula C8H8ClNO2 and molecular weight 185.02435 g/mol. IUPAC: methyl 3-amino-4-chlorobenzoate.