Ethyl 5-acetyloxy-1,2-dimethylindole-3-carboxylate
ethyl 5-acetyloxy-1,2-dimethylindole-3-carboxylate
Also Known As: Ethyl 5-acetoxy-1,2-dimethyl-1H-indole-3-carboxylate|ethyl 5-acetyloxy-1,2-dimethylindole-3-carboxylate|Arbidol Impurity 8|Arbidol Impurity 13|ACETOXYINDOLE|Arbidol Impurity 54|ethyl 5-(acetyloxy)-1,2-dimethyl-1H-indole-3-carboxylate|Oprea1_760508|Oprea1_763403|5597AB|BAS 00444672|KS-000048J6|UPCMLD0ENAT5950967:001|NCGC00245126-01|NCGC00245126-02|1,2-dimethyl-3-carbethoxy-5-acetoxyindole|5-Acetoxy-1,2-dimethyl-1H-indole-3-carboxylic acid ethyl ester
| Molecular Formula | C15H17NO4 |
|---|---|
| Molecular Weight | 275.11575 g/mol |
| LogP | 2.4 |
| Topological Polar Surface Area | 57.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 275.11575 |
| Monoisotopic Mass | 275.11575 |
| Heavy Atoms | 20 |
| Complexity | 384.0 |
Chemical Identifiers
| CAS Number | 40945-79-7 |
|---|---|
| SMILES | CCOC(=O)C1=C(N(C2=C1C=C(C=C2)OC(=O)C)C)C |
| InChIKey | AEWNSBCPMQKSLN-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Ethyl 5-acetyloxy-1,2-dimethylindole-3-carboxylate (CAS 40945-79-7), with molecular formula C15H17NO4 and molecular weight 275.11575 g/mol. IUPAC: ethyl 5-acetyloxy-1,2-dimethylindole-3-carboxylate.