6-Chloro-3-(trifluoromethyl)-(1,2,4)triazolo(4,3-b)pyridazine
6-chloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine
Also Known As: 6-chloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine|6-chloro-3-(trifluoromethyl)[1,2,4]triazolo[4,3-b]pyridazine|[1,3]DITHIEPANE|KS-00001WNV|8-Chloro-tetrazolo<1,5-a>pyridin|BAS 00583559|4M-731|SR-01000530696-1|SR-01000530696-3|6-Chloro-3-trifluoromethyl-[1,2,4]triazolo[4,3-b]pyridazine|BRD-K34021812-001-06-6|6-chloro-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-f]pyridazine|F0912-0525|6-CHLORO-3- [1,2,4]TRIAZOLO[4,3-B]PYRIDAZINE|A2321/0097862|6-Chloro-3-trifluoromethyl-1,2,4-triazolo[4,3-b]pyridazine
| Molecular Formula | C6H2ClF3N4 |
|---|---|
| Molecular Weight | 221.992 g/mol |
| LogP | 1.6 |
| Topological Polar Surface Area | 43.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 0 |
| Exact Mass | 221.992 |
| Monoisotopic Mass | 221.992 |
| Heavy Atoms | 14 |
| Complexity | 224.0 |
Chemical Identifiers
| CAS Number | 40971-95-7 |
|---|---|
| SMILES | C1=CC(=NN2C1=NN=C2C(F)(F)F)Cl |
| InChIKey | IJESFQCCOFNOQG-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
6-Chloro-3-(trifluoromethyl)-(1,2,4)triazolo(4,3-b)pyridazine (CAS 40971-95-7), with molecular formula C6H2ClF3N4 and molecular weight 221.992 g/mol. IUPAC: 6-chloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine.