[4-(4-Chlorophenyl)phenyl]methanamine
[4-(4-chlorophenyl)phenyl]methanamine
Also Known As: 4'-Chloro-biphenyl-4-methanamine|AKOS BAR-2006|[4-(4-chlorophenyl)phenyl]methanamine|4'-chloro-[1,1'-Biphenyl]-4-methanamine|4-Chloro-biphenyl-4-methanamine|4-(4-Chlorophenyl)benzylamine hydrochloride|J3.253.886J|[1,1'-Biphenyl]-4-methanamine, 4'-chloro-|4 -Chloro-1,1 -biphenyl-4-methaneamine|(4'-chloro-[1,1'-biphenyl]-4-yl)methanamine|1-(4'-Chloro[1,1'-biphenyl]-4-yl)methanamine|[4-(4-chlorophenyl)phenyl]methylamine hydrochloride|C-(4'-Chloro-biphenyl-4-yl)-methylamine 1HCl salt|1-{4'-CHLORO-[1,1'-BIPHENYL]-4-YL}METHANAMINE
| Molecular Formula | C13H12ClN |
|---|---|
| Molecular Weight | 217.06583 g/mol |
| LogP | 3.4657 |
| Topological Polar Surface Area | 26.02 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 217.06583 |
| Monoisotopic Mass | 217.06583 |
| Heavy Atoms | 15 |
| Complexity | 431.09805 |
Chemical Identifiers
| CAS Number | 410077-96-2 |
|---|---|
| SMILES | C1=CC(=CC=C1CN)C2=CC=C(C=C2)Cl |
Product Overview
[4-(4-Chlorophenyl)phenyl]methanamine (CAS 410077-96-2), with molecular formula C13H12ClN and molecular weight 217.06583 g/mol. IUPAC: [4-(4-chlorophenyl)phenyl]methanamine.