Disilaselenane, 1,1,1,3,3,3-hexamethyl-
trimethyl(trimethylsilylselanyl)silane
Also Known As: [Bis(trimethylsilyl)]selenide|BIS(TRIMETHYLSILYL)SELENIDE|Hexamethyldisilaselenane|Bis(trimethylsilyl) selenide|Selenobis(trimethylsilane)|bis (trimethylsilyl)selenium|bis(trimethylsilyl) selenium|trimethyl(trimethylsilylselanyl)silane|[bis-(Trimethylsilyl)]selenide|1,1,1,3,3,3-Hexamethyldisilaselenane|KST-1B4103|TRIMETHYL[(TRIMETHYLSILYL)SELANYL]SILANE|1,1,1,3,3,3-Hexamethyldisilaselenane #|Disilaselenane, 1,1,1,3,3,3-hexamethyl-|803-972-1
| Molecular Formula | C6H18SeSi2 |
|---|---|
| Molecular Weight | 226.01123 g/mol |
| LogP | 2.3604 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 2 |
| Exact Mass | 226.01123 |
| Monoisotopic Mass | 226.01123 |
| Heavy Atoms | 9 |
| Complexity | 76.0 |
Chemical Identifiers
| CAS Number | 41287-39-2 |
|---|---|
| SMILES | C[Si](C)(C)[Se][Si](C)(C)C |
| InChIKey | FKIZDWBGWFWWOV-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 8 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Disilaselenane, 1,1,1,3,3,3-hexamethyl- (CAS 41287-39-2), with molecular formula C6H18SeSi2 and molecular weight 226.01123 g/mol. IUPAC: trimethyl(trimethylsilylselanyl)silane.