5-(3-Chlorophenyl)furan-2-carboxylic acid
5-(3-chlorophenyl)furan-2-carboxylic acid
Also Known As: 5-(3-chlorophenyl)furan-2-carboxylic acid|5-(3-chlorophenyl)-2-furoic acid|5-(3-Chloro-phenyl)-furan-2-carboxylic acid|QC-183|2-Furancarboxylicacid, 5-(3-chlorophenyl)-|BAS 03847412|2-Furancarboxylic acid, 5-(3-chlorophenyl)-|5-(3-Chlorophenyl)-2-carboxylic acid|5-(3-chlorophenyl)-2-furancarboxylic acid|PS-5896|5-(3-chloro-phenyl)furan-2-carboxylic acid|BB 0222389|J2.111.077I|K-8706|SR-01000362760-1|5-(3-Chlorophenyl)-2-furancarboxylic Acid; 5-(3-Chlorophenyl)-2-furoic Acid; 5-(m-Chlorophenyl)-2-furancarboxylic Acid
| Molecular Formula | C11H7ClO3 |
|---|---|
| Molecular Weight | 222.00838 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 50.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 222.00838 |
| Monoisotopic Mass | 222.00838 |
| Heavy Atoms | 15 |
| Complexity | 244.0 |
Chemical Identifiers
| CAS Number | 41287-72-3 |
|---|---|
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC=C(O2)C(=O)O |
| InChIKey | OWEBZHHXEPQWQW-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
5-(3-Chlorophenyl)furan-2-carboxylic acid (CAS 41287-72-3), with molecular formula C11H7ClO3 and molecular weight 222.00838 g/mol. IUPAC: 5-(3-chlorophenyl)furan-2-carboxylic acid.