5-(4-Chlorophenyl)-2-furoic acid
5-(4-chlorophenyl)furan-2-carboxylic acid
Also Known As: 5-(4-Chlorophenyl)-2-furoic acid|5-(4-chlorophenyl)furan-2-carboxylic Acid|Acid, 62|ACMC-1AN70|5- -2-FUROICACID|5-(p-chlorophenyl)furoic acid|5-(4-Chloro-phenyl)-furan-2-carboxylic acid|5-(4-chlorophenyl)furoic acid|96% HPLC|2-Furancarboxylic acid, 5-(4-chlorophenyl)-|5-(p-Chlorophenyl)-2furoic acid|5-(p-chlorophenyl)-2-furoic acid|Fr13371|FS-5293|5-(4-Chlorophenyl)-2-furoic acid, 97%|5-(4-chlorophenyl)uran-2-carboxylic acid|US12427135, Code BTB13086|5-(4-Chlorophenyl)-2-furancarboxylic acid
| Molecular Formula | C11H7ClO3 |
|---|---|
| Molecular Weight | 222.00838 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 50.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 222.00838 |
| Monoisotopic Mass | 222.00838 |
| Heavy Atoms | 15 |
| Complexity | 236.0 |
Chemical Identifiers
| CAS Number | 41287-73-4 |
|---|---|
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)C(=O)O)Cl |
| InChIKey | XIPQHWUSDHTXOO-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 7 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
5-(4-Chlorophenyl)-2-furoic acid (CAS 41287-73-4), with molecular formula C11H7ClO3 and molecular weight 222.00838 g/mol. IUPAC: 5-(4-chlorophenyl)furan-2-carboxylic acid.