1,10-Phenanthroline-3,8-dicarboxylic acid, 4,7-dihydroxy-, 3,8-diethyl ester
diethyl 4,7-dioxo-1,10-dihydro-1,10-phenanthroline-3,8-dicarboxylate
Also Known As: Diethyl 4,7-dihydroxy-1,10-phenanthroline-3,8-dicarboxylate|3,8-Dicarboethoxy-4,7-dihydroxy-1,10-phenanthroline|diethyl 4,7-dioxo-1,10-dihydro-1,10-phenanthroline-3,8-dicarboxylate|1,10-Phenanthroline-3,8-dicarboxylic acid, 4,7-dihydroxy-, diethyl ester|1,10-Phenanthroline-3,8-dicarboxylic acid, 4,7-dihydroxy-, 3,8-diethyl ester|3,8-diethyl 4,7-dihydroxy-1,10-phenanthroline-3,8-dicarboxylate|4,7-Dihydroxy-1,10-phenanthroline-3,8-dicarboxylic acid diethyl ester
| Molecular Formula | C18H16N2O6 |
|---|---|
| Molecular Weight | 356.10083 g/mol |
| LogP | 2.1 |
| Topological Polar Surface Area | 111.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Exact Mass | 356.10083 |
| Monoisotopic Mass | 356.10083 |
| Heavy Atoms | 26 |
| Complexity | 650.0 |
Chemical Identifiers
| CAS Number | 41287-85-8 |
|---|---|
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=CC3=C2NC=C(C3=O)C(=O)OCC |
| InChIKey | PMZGJTQGPUEOKK-UHFFFAOYSA-N |
Product Overview
1,10-Phenanthroline-3,8-dicarboxylic acid, 4,7-dihydroxy-, 3,8-diethyl ester (CAS 41287-85-8), with molecular formula C18H16N2O6 and molecular weight 356.10083 g/mol. IUPAC: diethyl 4,7-dioxo-1,10-dihydro-1,10-phenanthroline-3,8-dicarboxylate.