4-(Diphenylmethyl)piperazinyl 3,4,5-trimethoxyphenyl ketone
(4-benzhydrylpiperazin-1-yl)-(3,4,5-trimethoxyphenyl)methanone
Also Known As: Oprea1_189204|BAS 04086523|AI-981/10248009|1-benzhydryl-4-(3,4,5-trimethoxybenzoyl)piperazine|4-(diphenylmethyl)piperazinyl 3,4,5-trimethoxyphenyl ketone|(4-benzhydrylpiperazin-1-yl)(3,4,5-trimethoxyphenyl)methanone|(4-Benzhydryl-piperazin-1-yl)-(3,4,5-trimethoxy-phenyl)-methanone|(4-benzhydrylpiperazin-1-yl)-(3,4,5-trimethoxyphenyl)methanone|[4-(diphenylmethyl)piperazin-1-yl](3,4,5-trimethoxyphenyl)methanone|1-(DIPHENYLMETHYL)-4-(3,4,5-TRIMETHOXYBENZOYL)PIPERAZINE
| Molecular Formula | C27H30N2O4 |
|---|---|
| Molecular Weight | 446.22055 g/mol |
| LogP | 4.2598 |
| Topological Polar Surface Area | 51.24 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Exact Mass | 446.22055 |
| Monoisotopic Mass | 446.22055 |
| Heavy Atoms | 33 |
| Complexity | 999.48926 |
Chemical Identifiers
| CAS Number | 41332-22-3 |
|---|---|
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)N2CCN(CC2)C(C3=CC=CC=C3)C4=CC=CC=C4 |
Product Overview
4-(Diphenylmethyl)piperazinyl 3,4,5-trimethoxyphenyl ketone (CAS 41332-22-3), with molecular formula C27H30N2O4 and molecular weight 446.22055 g/mol. IUPAC: (4-benzhydrylpiperazin-1-yl)-(3,4,5-trimethoxyphenyl)methanone.